CAS 118767-93-4

7-Chloro-2-methyloxazolo[5,4-d]pyrimidine

Description:

7-Chloro-2-methyloxazolo[5,4-d]pyrimidine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both oxazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and a methyl group at the 2-position of the oxazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorine atom can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its synthesis and characterization are important for understanding its reactivity and applications in various fields, including agrochemicals and pharmaceuticals. As with many heterocycles, the specific interactions and stability can vary based on environmental factors such as pH and temperature.

Formula: C₆H₄ClN₃O

InChI: InChI=1S/C6H4ClN3O/c1-3-10-4-5(7)8-2-9-6(4)11-3/h2H,1H3

InChI key: InChIKey=CAUBDSHPZNRFJH-UHFFFAOYSA-N

SMILES: ClC1=C2C(OC(C)=N2)=NC=N1

Synonyms:

• Oxazolo[5,4-d]pyrimidine, 7-chloro-2-methyl-
• 7-Chloro-2-methyloxazolo[5,4-d]pyrimidine