CymitQuimica logo

CAS 1187767-01-6

:

5-(2,5-Dimethyl-3-furanyl)-4-methyl-1H-pyrazol-3-amine

Description:
5-(2,5-Dimethyl-3-furanyl)-4-methyl-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a furan moiety. The presence of the dimethyl-substituted furan indicates that it may exhibit interesting electronic properties and potential reactivity due to the electron-donating nature of the methyl groups. The pyrazole ring contributes to the compound's potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. This compound may possess various functional groups that could influence its solubility, stability, and interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's specific CAS number allows for precise identification and retrieval of data related to its properties, synthesis, and applications in scientific literature. Overall, 5-(2,5-Dimethyl-3-furanyl)-4-methyl-1H-pyrazol-3-amine represents a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-5-4-8(7(3)14-5)9-6(2)10(11)13-12-9/h4H,1-3H3,(H3,11,12,13)
InChI key:InChIKey=QHIXUGTXUBTMEF-UHFFFAOYSA-N
SMILES:CC1=C(NN=C1N)C2=C(C)OC(C)=C2
Synonyms:
  • 1H-Pyrazol-3-amine, 5-(2,5-dimethyl-3-furanyl)-4-methyl-
  • 5-(2,5-Dimethyl-3-furanyl)-4-methyl-1H-pyrazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.