CymitQuimica logo

CAS 1187830-52-9

:

Pyrido[3,4-d]pyrimidine-4-acetic acid, 5,6,7,8-tetrahydro-, ethyl ester, hydrochloride (1:1)

Description:
Pyrido[3,4-d]pyrimidine-4-acetic acid, 5,6,7,8-tetrahydro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the ester moiety. As a hydrochloride salt, it is likely to be soluble in water and exhibit enhanced stability compared to its free base form. The tetrahydro configuration suggests that the compound may have a saturated ring system, which can influence its reactivity and biological activity. Such compounds are often of interest in medicinal chemistry for their potential pharmacological properties, including anti-inflammatory or antimicrobial effects. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature reference for precise values. Overall, this compound represents a unique scaffold that may be explored for various applications in drug development and chemical synthesis.
Formula:C11H15N3O2·ClH
InChI:InChI=1S/C11H15N3O2.ClH/c1-2-16-11(15)5-9-8-3-4-12-6-10(8)14-7-13-9;/h7,12H,2-6H2,1H3;1H
InChI key:InChIKey=NHAMARPLFWZOAB-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1=C2C(=NC=N1)CNCC2.Cl
Synonyms:
  • Pyrido[3,4-d]pyrimidine-4-acetic acid, 5,6,7,8-tetrahydro-, ethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.