CAS 1187830-70-1
:1H-Isoindole, 5-bromo-2,3-dihydro-2-(phenylmethyl)-, hydrochloride (1:1)
Description:
1H-Isoindole, 5-bromo-2,3-dihydro-2-(phenylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 5-position introduces halogen functionality, which can influence the compound's reactivity and biological activity. The 2-(phenylmethyl) substituent indicates the presence of a benzyl group, contributing to the compound's lipophilicity and potential interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular characteristics, including molecular weight and specific functional groups, play a crucial role in determining its behavior in chemical reactions and biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents.
Formula:C15H14BrN·ClH
InChI:InChI=1S/C15H14BrN.ClH/c16-15-7-6-13-10-17(11-14(13)8-15)9-12-4-2-1-3-5-12;/h1-8H,9-11H2;1H
InChI key:InChIKey=WZYCLORMOXDGHP-UHFFFAOYSA-N
SMILES:C(N1CC=2C(C1)=CC(Br)=CC2)C3=CC=CC=C3.Cl
Synonyms:- 1H-Isoindole, 5-bromo-2,3-dihydro-2-(phenylmethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
