CAS 1187830-73-4
:Pyrido[4,3-d]pyrimidine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1)
Description:
Pyrido[4,3-d]pyrimidine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The methyl group at the 4-position enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the hydrochloride, affecting its pharmacokinetic properties. Overall, this compound's unique structural features and properties make it a subject of interest in research, particularly in the development of therapeutic agents.
Formula:C8H12ClN3
InChI:InChI=1S/C8H11N3.ClH/c1-6-7-4-9-3-2-8(7)11-5-10-6;/h5,9H,2-4H2,1H3;1H
InChI key:InChIKey=OUIUFCPVIBNAQJ-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=N1)CCNC2.Cl
Synonyms:- Pyrido[4,3-d]pyrimidine, 5,6,7,8-tetrahydro-4-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6,7,8-Tetrahydro-4-methylpyrido[4,3-d]pyrimidine hcl
CAS:Formula:C8H12ClN3Molecular weight:185.6540
