CymitQuimica logo

CAS 1187830-84-7

:

5H,6H,7H,8H-imidazo[1,2-a]pyrazine hydrochloride

Description:
5H,6H,7H,8H-imidazo[1,2-a]pyrazine hydrochloride is a heterocyclic compound characterized by its imidazo and pyrazine ring structures, which contribute to its unique chemical properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form enhances its stability and solubility. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of nitrogen atoms in its structure that can interact with biological targets. The compound's molecular structure allows for various functionalizations, which can lead to derivatives with altered pharmacological profiles. As with many heterocycles, it may exhibit interesting electronic properties, making it a subject of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C6H10ClN3
InChI:InChI=1S/C6H9N3.ClH/c1-3-9-4-2-8-6(9)5-7-1;/h2,4,7H,1,3,5H2;1H
InChI key:HHISCLFBXNGLCE-UHFFFAOYSA-N
SMILES:C1CN2C=CN=C2CN1.Cl
Found 4 products.