CymitQuimica logo

CAS 1187830-90-5

:

1H-Pyrazolo[3,4-c]pyridine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)

Description:
1H-Pyrazolo[3,4-c]pyridine, 4,5,6,7-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. It is often used in medicinal chemistry and pharmacological research due to its potential biological activities, including effects on various receptors and enzymes. The presence of the tetrahydro moiety suggests that it may exhibit unique properties compared to its fully aromatic counterparts, potentially influencing its reactivity and interaction with biological targets. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other interactions that are significant in drug design. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C6H9N3·ClH
InChI:InChI=1S/C6H9N3.ClH/c1-2-7-4-6-5(1)3-8-9-6;/h3,7H,1-2,4H2,(H,8,9);1H
InChI key:InChIKey=MGEFXKKDBHBPEO-UHFFFAOYSA-N
SMILES:C12=C(NN=C1)CNCC2.Cl
Synonyms:
  • 1H-Pyrazolo[3,4-c]pyridine, 4,5,6,7-tetrahydro-, hydrochloride (1:1)
Found 4 products.