CAS 1187830-93-8
:3,4-Pyridinediamine, 2-chloro-, hydrochloride (1:1)
Description:
3,4-Pyridinediamine, 2-chloro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which features two amino groups at the 3 and 4 positions and a chlorine substituent at the 2 position. This compound exists as a hydrochloride salt, indicating that it is typically encountered in a protonated form, enhancing its solubility in water. The presence of amino groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its chlorinated structure may impart unique reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's molecular properties, such as melting point, boiling point, and solubility, are influenced by its functional groups and the hydrochloride form. Safety data should be consulted, as the presence of chlorine and amine groups may pose specific hazards. Overall, 3,4-Pyridinediamine, 2-chloro-, hydrochloride (1:1) is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C5H6ClN3·ClH
InChI:InChI=1S/C5H6ClN3.ClH/c6-5-4(8)3(7)1-2-9-5;/h1-2H,8H2,(H2,7,9);1H
InChI key:InChIKey=ANHMYXFNVINUSP-UHFFFAOYSA-N
SMILES:NC=1C(N)=CC=NC1Cl.Cl
Synonyms:- 3,4-Pyridinediamine, 2-chloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
