
CAS 1187836-87-8
:2-Bromo-4-(bromomethyl)-5-methylthiazole
Description:
2-Bromo-4-(bromomethyl)-5-methylthiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features two bromine substituents: one at the 2-position and another at the 4-(bromomethyl) position, along with a methyl group at the 5-position. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The thiazole moiety contributes to its biological activity, as many thiazole derivatives exhibit antimicrobial, antifungal, and anticancer properties. The compound is typically a solid at room temperature and may have specific solubility characteristics depending on the solvent. Safety data should be consulted for handling, as brominated compounds can pose health risks. Overall, 2-Bromo-4-(bromomethyl)-5-methylthiazole is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C5H5Br2NS
InChI:InChI=1S/C5H5Br2NS/c1-3-4(2-6)8-5(7)9-3/h2H2,1H3
InChI key:InChIKey=SQSBWYSRKYKNGH-UHFFFAOYSA-N
SMILES:C(Br)C1=C(C)SC(Br)=N1
Synonyms:- 2-Bromo-4-(bromomethyl)-5-methylthiazole
- Thiazole, 2-bromo-4-(bromomethyl)-5-methyl-
- 2-Bromo-4-(bromomethyl)-5-methyl-1,3-thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.