CAS 118790-68-4
:N-[3,3-bis(4-fluorophenyl)propyl]-N,N'-dimethyl-N'-(3,4,5-trimethoxybenzyl)ethane-1,2-diamine
Description:
N-[3,3-bis(4-fluorophenyl)propyl]-N,N'-dimethyl-N'-(3,4,5-trimethoxybenzyl)ethane-1,2-diamine, with CAS number 118790-68-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic and aliphatic components. This compound features a central ethane-1,2-diamine backbone, substituted with a dimethyl group and a bulky 3,4,5-trimethoxybenzyl moiety, as well as a propyl chain that is further substituted with two 4-fluorophenyl groups. The presence of fluorine atoms in the phenyl rings may enhance the compound's lipophilicity and biological activity. The methoxy groups contribute to its solubility and potential interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and potential applications would be subjects of further investigation in both academic and pharmaceutical contexts.
Formula:C29H36F2N2O3
InChI:InChI=1/C29H36F2N2O3/c1-32(16-17-33(2)20-21-18-27(34-3)29(36-5)28(19-21)35-4)15-14-26(22-6-10-24(30)11-7-22)23-8-12-25(31)13-9-23/h6-13,18-19,26H,14-17,20H2,1-5H3
Synonyms:- 1,2-Ethanediamine, N-(3,3-bis(4-fluorophenyl)propyl)-N,N'-dimethyl-N'-((3,4,5-trimethoxyphenyl)methyl)-
- SIM 6080
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SIM-6080
CAS:SIM-6080 is a calcium channel antagonist. SIM-6080 inhibits the proliferation of rat aortic myocytes.Formula:C29H36F2N2O3Color and Shape:SolidMolecular weight:498.6
