CAS 1187926-98-2
:4-(4-Chlorophenyl)tetrahydro-2H-pyran
Description:
4-(4-Chlorophenyl)tetrahydro-2H-pyran is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether featuring five carbon atoms and one oxygen atom. The presence of a 4-chlorophenyl group indicates that a chlorinated phenyl substituent is attached to the tetrahydropyran, contributing to its chemical properties and reactivity. This compound is typically colorless to pale yellow in appearance and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can influence biological activity. The chlorophenyl group may enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine atom, which can participate in various chemical reactions. Overall, 4-(4-Chlorophenyl)tetrahydro-2H-pyran represents a versatile structure in organic synthesis and drug development.
Formula:C11H13ClO
InChI:InChI=1S/C11H13ClO/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-4,10H,5-8H2
InChI key:InChIKey=HSKMDAXFXBJBCS-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C=C1)C2CCOCC2
Synonyms:- 4-(4-Chlorophenyl)tetrahydropyran
- 2H-Pyran, 4-(4-chlorophenyl)tetrahydro-
- 4-(p-Chlorophenyl)tetrahydropyran
- 4-(4-Chlorophenyl)tetrahydro-2H-pyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

