CAS 1187927-13-4

2H-Pyran-4-acetic acid, α-aminotetrahydro-, methyl ester, (αR)-, ethanedioate (1:1)

Description:

2H-Pyran-4-acetic acid, α-aminotetrahydro-, methyl ester, (αR)-, ethanedioate (1:1) is a chemical compound characterized by its unique structure, which includes a pyran ring and an acetic acid moiety. This compound features a tetrahydro-α-amino group, indicating the presence of an amino group attached to a saturated carbon framework. The methyl ester functionality suggests that the carboxylic acid group is esterified with a methyl group, enhancing its solubility in organic solvents. The ethanedioate component indicates the presence of oxalic acid derivatives, which may influence the compound's reactivity and interactions. This compound is likely to exhibit polar characteristics due to the presence of both the carboxylic acid and amino groups, making it potentially soluble in polar solvents. Its stereochemistry, denoted by (αR)-, implies specific spatial arrangements that can affect its biological activity and interactions. Overall, this compound may have applications in pharmaceuticals or organic synthesis, but detailed studies would be necessary to elucidate its specific properties and potential uses.

Formula: C₈H₁₅NO₃·C₂H₂O₄

InChI: InChI=1S/C8H15NO3.C2H2O4/c1-11-8(10)7(9)6-2-4-12-5-3-6;3-1(4)2(5)6/h6-7H,2-5,9H2,1H3;(H,3,4)(H,5,6)/t7-;/m1./s1

InChI key: InChIKey=NMDJSINYHRDMSN-OGFXRTJISA-N

SMILES: [C@@H](C(OC)=O)(N)C1CCOCC1.C(C(O)=O)(O)=O

Synonyms:

• 2H-Pyran-4-acetic acid, α-aminotetrahydro-, methyl ester, (αR)-, ethanedioate (1:1)