CAS 1187927-20-3

Piperidine, 4-[4-(1H-imidazol-1-yl)phenoxy]-, hydrochloride (1:2)

Description:

Piperidine, 4-[4-(1H-imidazol-1-yl)phenoxy]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxy group substituted at the 4-position of the piperidine ring, along with an imidazole moiety attached to the phenyl group. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which typically enhances its solubility in water and stability. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and can interact with biological targets. The compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways. Its specific applications and effects would depend on further studies, including pharmacological evaluations. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen-containing heterocycles, which can have varying toxicity profiles.

Formula: C₁₄H₁₇N₃O·2ClH

InChI: InChI=1S/C14H17N3O.2ClH/c1-3-13(18-14-5-7-15-8-6-14)4-2-12(1)17-10-9-16-11-17;;/h1-4,9-11,14-15H,5-8H2;2*1H

InChI key: InChIKey=FKUGUQQNLNOUPH-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C=C1)N2C=CN=C2)C3CCNCC3.Cl

Synonyms:

• Piperidine, 4-[4-(1H-imidazol-1-yl)phenoxy]-, hydrochloride (1:2)

4-(4-(1H-Imidazol-1-yl)phenoxy)piperidine dihydrochloride

CAS: 1187927-20-3

Formula: C₁₄H₁₉Cl₂N₃O

Molecular weight: 316.2262

Ref: IN-DA00HEQK