
CAS 1187927-33-8
:Benzenecarboximidamide, 5-bromo-2-fluoro-, hydrochloride (1:1)
Description:
Benzenecarboximidamide, 5-bromo-2-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique structural features, including a benzene ring substituted with a carboximidamide group, a bromine atom at the 5-position, and a fluorine atom at the 2-position. This compound exists as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of halogen substituents, such as bromine and fluorine, often imparts distinct electronic properties and can affect the compound's reactivity and interaction with biological targets. The hydrochloride form typically indicates that the compound is a protonated amine, which can play a role in its pharmacological properties. Due to its structural characteristics, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific biological activities. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with halogenated compounds.
Formula:C7H6BrFN2·ClH
InChI:InChI=1S/C7H6BrFN2.ClH/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3H,(H3,10,11);1H
InChI key:InChIKey=QRQAJUJIJLZRSJ-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(F)C=CC(Br)=C1.Cl
Synonyms:- Benzenecarboximidamide, 5-bromo-2-fluoro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Bromo-2-fluorobenzene-1-carboximidamide hydrochloride
CAS:5-Bromo-2-fluorobenzene-1-carboximidamide hydrochloride
Molecular weight:253.49928g/mol


