CAS 1187927-37-2

Pyrrolo[3,4-c]pyrrole, octahydro-2-phenyl-, hydrochloride (1:2)

Description:

Pyrrolo[3,4-c]pyrrole, octahydro-2-phenyl-, hydrochloride (1:2) is a synthetic compound characterized by its complex bicyclic structure, which includes a pyrrole moiety fused to another pyrrole ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and stability under various conditions. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in polar solvents, making it suitable for various applications in pharmaceuticals or materials science. The octahydro configuration suggests that the compound has multiple saturated carbon atoms, contributing to its stability and possibly influencing its reactivity. Additionally, the phenyl group attached to the structure may impart unique electronic properties, affecting its interaction with biological targets or its behavior in chemical reactions. Overall, this compound's characteristics make it of interest in research and development, particularly in fields exploring novel therapeutic agents or advanced materials.

Formula: C₁₂H₁₆N₂·2ClH

InChI: InChI=1S/C12H16N2.2ClH/c1-2-4-12(5-3-1)14-8-10-6-13-7-11(10)9-14;;/h1-5,10-11,13H,6-9H2;2*1H

InChI key: InChIKey=ARVBADVNKVWNEY-UHFFFAOYSA-N

SMILES: N1(CC2C(C1)CNC2)C3=CC=CC=C3.Cl

Synonyms:

• Pyrrolo[3,4-c]pyrrole, octahydro-2-phenyl-, hydrochloride (1:2)
• 2-Phenyl-octahydropyrrolo[3,4-c]pyrrole dihydrochloride
• 2-Phenyloctahydropyrrolo[3,4-c]pyrrole dihydrochloride
• 2-Phenyl-octahydro-pyrrolo[3,4-c]pyrrole dihydrochloride

2-Phenyloctahydropyrrolo[3,4-c]pyrrole dihydrochloride

CAS: 1187927-37-2

Formula: C₁₂H₁₈Cl₂N₂

Molecular weight: 261.1907

Ref: IN-DA0092G6

2-Phenyloctahydropyrrolo[3,4-c]pyrrole dihydrochloride

CAS: 1187927-37-2

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₂·2HCl

Purity: Min. 95%

Molecular weight: 261.19 g/mol

Ref: 3D-MXB92737