CAS 1187927-47-4

Benzenecarboximidamide, 4-bromo-3-methyl-, hydrochloride (1:1)

Description:

Benzenecarboximidamide, 4-bromo-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzene ring substituted with a carboximidamide group and halogen atoms. The presence of the 4-bromo and 3-methyl substituents on the benzene ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further studies. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, this compound represents a class of organic molecules that can be explored for various chemical and biological applications.

Formula: C₈H₉BrN₂·ClH

InChI: InChI=1S/C8H9BrN2.ClH/c1-5-4-6(8(10)11)2-3-7(5)9;/h2-4H,1H3,(H3,10,11);1H

InChI key: InChIKey=GNEFCSIFJGGPNN-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(C)=C(Br)C=C1.Cl

Synonyms:

• Benzenecarboximidamide, 4-bromo-3-methyl-, hydrochloride (1:1)

4-Bromo-3-methylbenzene-1-carboximidamide hydrochloride

CAS: 1187927-47-4

Versatile small molecule scaffold

Formula: C₈H₁₀BrClN₂

Purity: Min. 95%

Molecular weight: 249.53 g/mol

Ref: 3D-MXB92747