CAS 1187927-55-4

Quinoline, 3-(4-piperidinylmethyl)-, hydrochloride (1:2)

Description:

Quinoline, 3-(4-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its quinoline backbone, which is a bicyclic aromatic structure containing a nitrogen atom. The presence of the piperidine moiety, a six-membered ring containing one nitrogen atom, contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for various receptors or enzymes, making it of interest in medicinal chemistry. Its structure suggests possible interactions with biological systems, which could lead to therapeutic effects. However, specific pharmacological data, toxicity profiles, and detailed applications would require further investigation through scientific literature and experimental studies. Overall, the compound's unique structural features and salt form position it as a candidate for further research in drug development and related fields.

Formula: C₁₅H₁₈N₂·2ClH

InChI: InChI=1S/C15H18N2.2ClH/c1-2-4-15-14(3-1)10-13(11-17-15)9-12-5-7-16-8-6-12;;/h1-4,10-12,16H,5-9H2;2*1H

InChI key: InChIKey=GAZDBKUVXMLEPF-UHFFFAOYSA-N

SMILES: C(C1=CC2=C(N=C1)C=CC=C2)C3CCNCC3.Cl

Synonyms:

• Quinoline, 3-(4-piperidinylmethyl)-, hydrochloride (1:2)