CymitQuimica logo

CAS 1187927-58-7

:

(3S)-3-(3-Bromophenoxy)pyrrolidine

Description:
(3S)-3-(3-Bromophenoxy)pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing ring. The "3S" designation indicates that the compound has a specific stereochemistry at the third carbon atom, which is crucial for its biological activity and interactions. The presence of a bromophenoxy group at this position introduces both a bromine atom and a phenoxy functional group, contributing to the compound's overall polarity and potential reactivity. This structure may influence its solubility in various solvents and its ability to interact with biological targets, making it of interest in medicinal chemistry. The compound's CAS number, 1187927-58-7, allows for precise identification in chemical databases. Overall, the unique combination of functional groups and stereochemistry in (3S)-3-(3-Bromophenoxy)pyrrolidine suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c11-8-2-1-3-9(6-8)13-10-4-5-12-7-10/h1-3,6,10,12H,4-5,7H2/t10-/m0/s1
InChI key:InChIKey=QLTUVIZNLSOEKT-JTQLQIEISA-N
SMILES:O(C1=CC(Br)=CC=C1)[C@H]2CCNC2
Synonyms:
  • Pyrrolidine, 3-(3-bromophenoxy)-, (3S)-
  • (3S)-3-(3-Bromophenoxy)pyrrolidine
  • (S)-3-(3-BroMophenoxy)-pyrrolidine HCl
  • (S)-3-(3-Bromo-phenoxy)-pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.