CAS 1187927-59-8

1,2,3,4-Tetrahydro-1,4,4-trimethyl-6-quinolinamine

Description:

1,2,3,4-Tetrahydro-1,4,4-trimethyl-6-quinolinamine is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of three methyl groups at the 4-position contributes to its steric bulk and may influence its reactivity and solubility. The amine functional group suggests potential basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems or with other chemical entities. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and behavior in various environments would depend on its molecular interactions, stability, and potential for forming derivatives. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would need to be determined experimentally for practical applications.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c1-12(2)6-7-14(3)11-5-4-9(13)8-10(11)12/h4-5,8H,6-7,13H2,1-3H3

InChI key: InChIKey=BWEJCNRADFZAKH-UHFFFAOYSA-N

SMILES: CC1(C)C=2C(N(C)CC1)=CC=C(N)C2

Synonyms:

• 1,2,3,4-Tetrahydro-1,4,4-trimethyl-6-quinolinamine
• 6-Quinolinamine, 1,2,3,4-tetrahydro-1,4,4-trimethyl-