CymitQuimica logo

CAS 1187927-61-2

:

Guanidine, N-(4-chlorophenyl)-, ethanedioate (1:1)

Description:
Guanidine, N-(4-chlorophenyl)-, ethanedioate (1:1) is a chemical compound characterized by its guanidine backbone, which is a derivative of guanidine featuring a 4-chlorophenyl group. This compound typically exhibits properties associated with both guanidine and carboxylate functionalities due to the presence of ethanedioate (oxalate) moieties. It is likely to be a white to off-white solid, soluble in polar solvents, and may exhibit basic properties due to the guanidine structure. The presence of the 4-chlorophenyl group can impart specific electronic and steric effects, potentially influencing its reactivity and interaction with biological systems. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a reagent in organic synthesis. Safety data and handling precautions should be observed, as with any chemical substance, particularly considering the presence of chlorine, which can pose environmental and health risks.
Formula:C7H8ClN3·C2H2O4
InChI:InChI=1S/C7H8ClN3.C2H2O4/c8-5-1-3-6(4-2-5)11-7(9)10;3-1(4)2(5)6/h1-4H,(H4,9,10,11);(H,3,4)(H,5,6)
InChI key:InChIKey=GPXRAZNDISFCGH-UHFFFAOYSA-N
SMILES:N(C(=N)N)C1=CC=C(Cl)C=C1.C(C(O)=O)(O)=O
Synonyms:
  • Guanidine, N-(4-chlorophenyl)-, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.