CAS 1187927-64-5

Carbamic acid, N-[(3S)-3-aminobutyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-[(3S)-3-aminobutyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its carbamate structure, which features a carbamic acid moiety linked to an amino group. The presence of the 1,1-dimethylethyl ester indicates that the compound has a bulky substituent, contributing to its steric properties. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may influence its stability and bioavailability. The (3S)-3-aminobutyl group indicates chirality, which can affect the compound's biological activity and interactions with enzymes or receptors. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity stemming from its structural features. As with many carbamate derivatives, it may exhibit properties such as inhibition of certain enzymes or modulation of neurotransmitter systems, making it relevant in various biochemical applications.

Formula: C₉H₂₀N₂O₂·ClH

InChI: InChI=1S/C9H20N2O2.ClH/c1-7(10)5-6-11-8(12)13-9(2,3)4;/h7H,5-6,10H2,1-4H3,(H,11,12);1H/t7-;/m0./s1

InChI key: InChIKey=CHJWJSGQPJFHRC-FJXQXJEOSA-N

SMILES: C(OC(C)(C)C)(NCC[C@H](C)N)=O.Cl

Synonyms:

• Carbamic acid, N-[(3S)-3-aminobutyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1)