CAS 1187927-74-7

Carbamic acid, N-[(3S)-3-aminobutyl]-, phenylmethyl ester, hydrochloride (1:1)

Description:

Carbamic acid, N-[(3S)-3-aminobutyl]-, phenylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a carbamic acid moiety linked to a phenylmethyl ester and an amino group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential for biological activity, possibly interacting with various biological targets. Its stereochemistry, indicated by the (3S) designation, implies that it has specific spatial arrangements that may influence its pharmacological properties. The compound may be used in research settings, particularly in medicinal chemistry, to explore its potential therapeutic applications. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₁₂H₁₈N₂O₂·ClH

InChI: InChI=1S/C12H18N2O2.ClH/c1-10(13)7-8-14-12(15)16-9-11-5-3-2-4-6-11;/h2-6,10H,7-9,13H2,1H3,(H,14,15);1H/t10-;/m0./s1

InChI key: InChIKey=SVSPLVWNFAKVRX-PPHPATTJSA-N

SMILES: C(OC(NCC[C@H](C)N)=O)C1=CC=CC=C1.Cl

Synonyms:

• Carbamic acid, N-[(3S)-3-aminobutyl]-, phenylmethyl ester, hydrochloride (1:1)