CymitQuimica logo

CAS 1187927-81-6

:

3-(4-Nitrophenoxy)piperidine

Description:
3-(4-Nitrophenoxy)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a nitrophenoxy group at the 3-position of the piperidine ring imparts specific chemical properties, including increased polarity and potential for hydrogen bonding due to the nitro group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, influenced by the functional groups present. The nitro group is known for its electron-withdrawing properties, which can affect the reactivity of the compound in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, 3-(4-Nitrophenoxy)piperidine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Safety and handling precautions should be observed, as nitro compounds can be hazardous. Overall, this compound exemplifies the interplay between structure and reactivity in organic chemistry.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c14-13(15)9-3-5-10(6-4-9)16-11-2-1-7-12-8-11/h3-6,11-12H,1-2,7-8H2
InChI key:InChIKey=WKAQCLQUGQACEV-UHFFFAOYSA-N
SMILES:O(C1=CC=C(N(=O)=O)C=C1)C2CCCNC2
Synonyms:
  • Piperidine, 3-(4-nitrophenoxy)-
  • 3-(4-Nitrophenoxy)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.