CymitQuimica logo

CAS 1187927-82-7

:

1,1-Dimethylethyl 4-amino-7-bromo-3,4-dihydro-1(2H)-quinolinecarboxylate

Description:
1,1-Dimethylethyl 4-amino-7-bromo-3,4-dihydro-1(2H)-quinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoline ring system, a carboxylate group, and a bromo substituent. The presence of the dimethyl group contributes to its steric bulk, influencing its reactivity and solubility. The amino group is likely to participate in hydrogen bonding, which can affect the compound's interactions with biological targets. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its CAS number, 1187927-82-7, allows for precise identification in chemical databases. The compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound represents a unique combination of features that may be explored for potential applications in pharmaceuticals or other chemical fields.
Formula:C14H19BrN2O2
InChI:InChI=1S/C14H19BrN2O2/c1-14(2,3)19-13(18)17-7-6-11(16)10-5-4-9(15)8-12(10)17/h4-5,8,11H,6-7,16H2,1-3H3
InChI key:InChIKey=BXYYWBRHZZJEJX-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C(N)CC1)=CC=C(Br)C2
Synonyms:
  • 1,1-Dimethylethyl 4-amino-7-bromo-3,4-dihydro-1(2H)-quinolinecarboxylate
  • 1(2H)-Quinolinecarboxylic acid, 4-amino-7-bromo-3,4-dihydro-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.