CAS 1187927-85-0

2-(4-Bromophenyl)-5-methyl-1H-imidazole

Description:

2-(4-Bromophenyl)-5-methyl-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromophenyl group at the 2-position and a methyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of biologically active compounds, due to the presence of the imidazole moiety, which is known for its role in various biological systems. The bromine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(4-Bromophenyl)-5-methyl-1H-imidazole is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₉BrN₂

InChI: InChI=1S/C10H9BrN2/c1-7-6-12-10(13-7)8-2-4-9(11)5-3-8/h2-6H,1H3,(H,12,13)

InChI key: InChIKey=AVDNQKPWJHMGHH-UHFFFAOYSA-N

SMILES: CC=1NC(C2=CC=C(Br)C=C2)=NC1

Synonyms:

• 2-(4-Bromophenyl)-5-methyl-1H-imidazole
• 2-(4-Bromophenyl)-4-methyl-1H-imidazole
• 1H-Imidazole, 2-(4-bromophenyl)-5-methyl-