CymitQuimica logo

CAS 1187927-90-7

:

Piperidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-nitrophenoxy group indicates that a nitro group is attached to a phenyl ring, which is further connected to the piperidine at the third position. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and medicinal chemistry. The nitro group contributes to the compound's electronic properties, potentially influencing its reactivity and biological activity. As a hydrochloride, it is often more stable and easier to handle than its free base form. The compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, and its specific interactions and applications would depend on the functional groups present and the overall molecular structure. Safety data and handling precautions should be observed due to the presence of the nitro group, which can be associated with toxicity and environmental concerns.
Formula:C11H14N2O3·ClH
InChI:InChI=1S/C11H14N2O3.ClH/c14-13(15)9-3-5-10(6-4-9)16-11-2-1-7-12-8-11;/h3-6,11-12H,1-2,7-8H2;1H
InChI key:InChIKey=VCKCQDDUQIHKEC-UHFFFAOYSA-N
SMILES:O(C1=CC=C(N(=O)=O)C=C1)C2CCCNC2.Cl
Synonyms:
  • Piperidine, 3-(4-nitrophenoxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.