CAS 1187927-93-0

1,4-Cyclohexanediamine, N1,N1-diethyl-, hydrochloride (1:2)

Description:

1,4-Cyclohexanediamine, N1,N1-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its structure, which includes a cyclohexane ring with two amine groups at the 1 and 4 positions, each substituted with diethyl groups. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it easier to handle in various applications. It is a colorless to light yellow crystalline solid with a relatively high melting point. The presence of amine functional groups suggests that it can participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions and complexation with acids. This compound may be used in organic synthesis, polymer chemistry, or as an intermediate in the production of other chemical substances. Safety data should be consulted, as amines can be irritants, and appropriate handling procedures should be followed to mitigate any potential health risks.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-3-12(4-2)10-7-5-9(11)6-8-10;;/h9-10H,3-8,11H2,1-2H3;2*1H

InChI key: InChIKey=JSGOAXICWAZNHJ-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1CCC(N)CC1.Cl

Synonyms:

• 1,4-Cyclohexanediamine, N1,N1-diethyl-, hydrochloride (1:2)