CymitQuimica logo

CAS 1187927-94-1

:

Benzoxazole, 2-[4-(1-piperazinyl)phenyl]-, hydrochloride (1:2)

Description:
Benzoxazole, 2-[4-(1-piperazinyl)phenyl]-, hydrochloride (1:2) is a chemical compound characterized by its benzoxazole core, which is a bicyclic structure containing both benzene and oxazole rings. The presence of a piperazine moiety attached to the phenyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical formulations. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with various biological targets, making it a candidate for drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, the unique structural features of this compound contribute to its relevance in research and potential therapeutic applications.
Formula:C17H17N3O·2ClH
InChI:InChI=1S/C17H17N3O.2ClH/c1-2-4-16-15(3-1)19-17(21-16)13-5-7-14(8-6-13)20-11-9-18-10-12-20;;/h1-8,18H,9-12H2;2*1H
InChI key:InChIKey=LVMSJNKHRHJAOE-UHFFFAOYSA-N
SMILES:C1(=NC=2C(O1)=CC=CC2)C3=CC=C(C=C3)N4CCNCC4.Cl
Synonyms:
  • Benzoxazole, 2-[4-(1-piperazinyl)phenyl]-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.