CAS 1187927-98-5
:1H-Indole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)
Description:
1H-Indole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features a carbonitrile group at the 5-position of the indole, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the hydrochloride indicates that the compound is in its salt form, which often enhances solubility in polar solvents and may influence its biological activity. The dihydro form suggests that the compound has undergone partial hydrogenation, affecting its electronic properties and stability. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its CAS number, 1187927-98-5, allows for precise identification in chemical databases. Overall, the characteristics of this compound make it a valuable subject for further investigation in both synthetic and medicinal chemistry contexts.
Formula:C9H8N2·ClH
InChI:InChI=1S/C9H8N2.ClH/c10-6-7-1-2-9-8(5-7)3-4-11-9;/h1-2,5,11H,3-4H2;1H
InChI key:InChIKey=YRRZEXJPRIRIFE-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C2C(=CC1)NCC2.Cl
Synonyms:- 1H-Indole-5-carbonitrile, 2,3-dihydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
