
CAS 1187928-04-6
:1-Pyrrolidinecarboxylic acid, 3-(4-piperidinylamino)-, 1,1-dimethylethyl ester, ethanedioate (1:1)
Description:
1-Pyrrolidinecarboxylic acid, 3-(4-piperidinylamino)-, 1,1-dimethylethyl ester, ethanedioate (1:1), with CAS number 1187928-04-6, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a piperidine moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, suggesting potential basicity and acidity. The presence of the dimethyl ester group indicates that it may have lipophilic characteristics, enhancing its solubility in organic solvents. The ethanedioate component suggests that it may form salts or complexes, which could influence its reactivity and stability. This compound may be of interest in medicinal chemistry due to its potential biological activity, possibly acting as a ligand or inhibitor in various biochemical pathways. Its synthesis and applications could be relevant in drug development, particularly in the context of targeting specific receptors or enzymes. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C14H27N3O2·C2H2O4
InChI:InChI=1S/C14H27N3O2.C2H2O4/c1-14(2,3)19-13(18)17-9-6-12(10-17)16-11-4-7-15-8-5-11;3-1(4)2(5)6/h11-12,15-16H,4-10H2,1-3H3;(H,3,4)(H,5,6)
InChI key:InChIKey=KNZAXESKAACAGT-UHFFFAOYSA-N
SMILES:N(C1CN(C(OC(C)(C)C)=O)CC1)C2CCNCC2.C(C(O)=O)(O)=O
Synonyms:- 1-Pyrrolidinecarboxylic acid, 3-(4-piperidinylamino)-, 1,1-dimethylethyl ester, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.