
CAS 1187928-07-9
:Piperazine, 1-cyclohexyl-3-methyl-, hydrochloride (1:2), (3R)-
Description:
Piperazine, 1-cyclohexyl-3-methyl-, hydrochloride (1:2), (3R)- is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This specific derivative features a cyclohexyl group and a methyl group attached to the piperazine ring, contributing to its unique properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The (3R) designation refers to the specific stereochemistry of the molecule, indicating the spatial arrangement of atoms around the chiral center, which can influence its biological activity and interactions. Generally, piperazine derivatives are known for their potential use in medicinal chemistry, particularly as anxiolytics, antidepressants, or in the treatment of various neurological disorders. The compound's safety, efficacy, and specific applications would depend on further research and clinical studies.
Formula:C11H22N2·2ClH
InChI:InChI=1S/C11H22N2.2ClH/c1-10-9-13(8-7-12-10)11-5-3-2-4-6-11;;/h10-12H,2-9H2,1H3;2*1H/t10-;;/m1../s1
InChI key:InChIKey=LOLWMYBMDSTFPW-YQFADDPSSA-N
SMILES:C[C@@H]1CN(CCN1)C2CCCCC2.Cl
Synonyms:- Piperazine, 1-cyclohexyl-3-methyl-, hydrochloride (1:2), (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.