CAS 1187928-09-1

1H-Inden-2-amine, 2,3-dihydro-2-(methoxymethyl)-, hydrochloride (1:1)

Description:

1H-Inden-2-amine, 2,3-dihydro-2-(methoxymethyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes an indene moiety. This compound features an amine functional group, contributing to its potential reactivity and biological activity. The presence of the methoxymethyl group enhances its solubility and may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of neuropharmacology or other therapeutic areas. Its specific interactions and effects would depend on the context of its use, including dosage and formulation. Safety and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities, which can be reactive or toxic under certain conditions.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c1-13-8-11(12)6-9-4-2-3-5-10(9)7-11;/h2-5H,6-8,12H2,1H3;1H

InChI key: InChIKey=UQBRDILFRIXTBN-UHFFFAOYSA-N

SMILES: C(OC)C1(N)CC=2C(C1)=CC=CC2.Cl

Synonyms:

• 1H-Inden-2-amine, 2,3-dihydro-2-(methoxymethyl)-, hydrochloride (1:1)

2-Methoxymethyl-indan-2-ylamine hydrochloride

CAS: 1187928-09-1

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-MXB92809