CAS 1187928-10-4: 1H-Indole-5-carboxylic acid, 2,3-dihydro-, methyl ester, hydrochloride (1:1)

Description: 1H-Indole-5-carboxylic acid, 2,3-dihydro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a carboxylic acid group and a methyl ester, contributing to its reactivity and solubility properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. Typically, indole derivatives exhibit a range of biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in pharmaceutical research. The presence of the methyl ester group suggests potential for further chemical modifications, which can be explored for various applications in medicinal chemistry. Additionally, the compound's molecular structure may influence its interaction with biological targets, making it a subject of study in drug development. Overall, this compound exemplifies the diverse chemistry associated with indole derivatives and their potential utility in various scientific fields.

Formula: C₁₀H₁₁NO₂·ClH

InChI: InChI=1S/C10H11NO2.ClH/c1-13-10(12)8-2-3-9-7(6-8)4-5-11-9;/h2-3,6,11H,4-5H2,1H3;1H

InChI key: InChIKey=SUEQCDVQNSWAGG-UHFFFAOYSA-N

SMILES: Cl.O=C(OC)C1=CC=C2NCCC2=C1

Synonyms:

• 1H-Indole-5-carboxylic acid, 2,3-dihydro-, methyl ester, hydrochloride (1:1)

5-Methoxycarbonyl-2,3-dihydro-1H-indole hydrochloride

CAS: 1187928-10-4

Versatile small molecule scaffold

• Formula: C₁₀H₁₂ClNO₂
• Purity: Min. 95%
• Molecular weight: 213.66 g/mol

5-Methoxycarbonyl-2,3-dihydro-1H-indole hydrochloride

CAS: 1187928-10-4

• Purity: 97%
• Molecular weight: 213.66000366210938