
CAS 1187928-15-9
:3-Furanmethanamine, α-methyl-, ethanedioate (1:1)
Description:
3-Furanmethanamine, α-methyl-, ethanedioate (1:1), identified by its CAS number 1187928-15-9, is a chemical compound that features a furan ring, an amine group, and an ethanedioate moiety. This compound is characterized by its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the furan ring, which is known for its reactivity and ability to participate in various chemical reactions. The α-methyl substitution enhances its steric properties, potentially influencing its biological activity and interaction with other molecules. The ethanedioate component suggests that this compound may form salts or complexes, which could be relevant in drug formulation or material science. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important to consider these factors in practical applications. Overall, this compound represents a unique structure that may offer interesting properties for further research and development in various fields of chemistry.
Formula:C6H9NO·C2H2O4
InChI:InChI=1S/C6H9NO.C2H2O4/c1-5(7)6-2-3-8-4-6;3-1(4)2(5)6/h2-5H,7H2,1H3;(H,3,4)(H,5,6)
InChI key:InChIKey=XLOCOIJMOWJZSN-UHFFFAOYSA-N
SMILES:C(C)(N)C=1C=COC1.C(C(O)=O)(O)=O
Synonyms:- 3-Furanmethanamine, α-methyl-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.