CAS 1187928-20-6

Hydrazine, (4-chloro-1-naphthalenyl)-, hydrochloride (1:1)

Description:

Hydrazine, (4-chloro-1-naphthalenyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydrazine functional group combined with a 4-chloro-1-naphthyl moiety. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting the presence of the hydrochloride salt form. It is often utilized in various chemical syntheses and may exhibit biological activity, making it of interest in pharmaceutical research. The presence of the chloro substituent on the naphthalene ring can influence its reactivity and interaction with biological targets. As with many hydrazine derivatives, it may pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory settings. Additionally, its chemical properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a specific class of hydrazine derivatives with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₀H₉ClN₂·ClH

InChI: InChI=1S/C10H9ClN2.ClH/c11-9-5-6-10(13-12)8-4-2-1-3-7(8)9;/h1-6,13H,12H2;1H

InChI key: InChIKey=OYEJVFMBQSZDDR-UHFFFAOYSA-N

SMILES: N(N)C=1C2=C(C(Cl)=CC1)C=CC=C2.Cl

Synonyms:

• Hydrazine, (4-chloro-1-naphthalenyl)-, hydrochloride (1:1)

(4-Chloro-naphthalen-1-yl)-hydrazine hydrochloride

CAS: 1187928-20-6

Formula: C₁₀H₁₀Cl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 229.1058

Ref: IN-DA01DN9I