CymitQuimica logo

CAS 1187928-22-8

:

1-Piperidinecarboxylic acid, 4-(5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:
1-Piperidinecarboxylic acid, 4-(5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1), with CAS number 1187928-22-8, is a chemical compound characterized by its complex structure that includes a piperidine ring, a pyridine moiety, and ester functionalities. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. The presence of the piperidine and pyridine rings suggests potential biological activity, as these structures are often found in pharmacologically active compounds. The dimethyl ester group may enhance lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the ethanedioate component indicates the presence of a dicarboxylic acid derivative, which could contribute to its acidity and potential for forming salts. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features that could interact with biological targets. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C15H23N3O2·C2H2O4
InChI:InChI=1S/C15H23N3O2.C2H2O4/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)13-5-4-12(16)10-17-13;3-1(4)2(5)6/h4-5,10-11H,6-9,16H2,1-3H3;(H,3,4)(H,5,6)
InChI key:InChIKey=SZXVRBCRQYQBLK-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(CC1)C2=CC=C(N)C=N2.C(C(O)=O)(O)=O
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-(5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.