
CAS 1187928-27-3
:2H-1,4-Benzoxazine-3-methanol, 3,4-dihydro-, ethanedioate (1:1)
Description:
2H-1,4-Benzoxazine-3-methanol, 3,4-dihydro-, ethanedioate (1:1), identified by its CAS number 1187928-27-3, is a chemical compound characterized by its unique structural features, which include a benzoxazine ring and a methanol moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the ethanedioate moiety suggests that it may participate in various chemical reactions, including esterification and potential coordination with metal ions. Its benzoxazine structure is known for its thermal stability and ability to undergo polymerization, making it of interest in materials science, particularly in the development of thermosetting resins. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, the characteristics of this substance make it a candidate for applications in advanced materials and possibly in pharmaceuticals, depending on its reactivity and interaction with biological systems.
Formula:C9H11NO2·C2H2O4
InChI:InChI=1S/C9H11NO2.C2H2O4/c11-5-7-6-12-9-4-2-1-3-8(9)10-7;3-1(4)2(5)6/h1-4,7,10-11H,5-6H2;(H,3,4)(H,5,6)
InChI key:InChIKey=CZIAYCDIHVMVEV-UHFFFAOYSA-N
SMILES:C(O)C1NC=2C(OC1)=CC=CC2.C(C(O)=O)(O)=O
Synonyms:- 2H-1,4-Benzoxazine-3-methanol, 3,4-dihydro-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.