
CAS 1187928-33-1
:4-Thiazolemethanamine, 2-(3-fluorophenyl)-, hydrochloride (1:1)
Description:
4-Thiazolemethanamine, 2-(3-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiazole and amine functional groups, which contribute to its potential biological activity. The presence of a 3-fluorophenyl group suggests that it may exhibit unique electronic properties and interactions due to the fluorine atom's electronegativity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly for its potential use in drug development, given the structural motifs that are often associated with pharmacological activity. Its molecular structure may allow for interactions with various biological targets, making it a candidate for further research in therapeutic contexts. However, specific data regarding its toxicity, stability, and detailed biological effects would require empirical studies and literature review for comprehensive understanding.
Formula:C10H9FN2S·ClH
InChI:InChI=1S/C10H9FN2S.ClH/c11-8-3-1-2-7(4-8)10-13-9(5-12)6-14-10;/h1-4,6H,5,12H2;1H
InChI key:InChIKey=SFZDBJZEDHGHLU-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(SC1)C2=CC(F)=CC=C2.Cl
Synonyms:- 4-Thiazolemethanamine, 2-(3-fluorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2-(3-Fluorophenyl)thiazol-4-yl)methanamine hydrochloride
CAS:Formula:C10H10ClFN2SMolecular weight:244.7162[2-(3-Fluorophenyl)-1,3-thiazol-4-yl]methanamine hydrochloride
CAS:[2-(3-Fluorophenyl)-1,3-thiazol-4-yl]methanamine hydrochloride
Molecular weight:244.7162g/mol


