CAS 1187928-38-6

1H-Indole, 2,3-dihydro-4-methyl-, hydrochloride (1:1)

Description:

1H-Indole, 2,3-dihydro-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The "2,3-dihydro" designation indicates that the compound has a saturated bond at the 2 and 3 positions of the indole ring, contributing to its stability and reactivity. The "4-methyl" refers to a methyl group attached to the fourth carbon of the indole structure, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water than its free base form, making it easier to handle in various applications. This compound may exhibit pharmacological properties, as many indole derivatives are known for their roles in medicinal chemistry, including potential effects on the central nervous system. Its CAS number, 1187928-38-6, uniquely identifies this specific compound in chemical databases, facilitating research and regulatory processes.

Formula: C₉H₁₁N·ClH

InChI: InChI=1S/C9H11N.ClH/c1-7-3-2-4-9-8(7)5-6-10-9;/h2-4,10H,5-6H2,1H3;1H

InChI key: InChIKey=IEIFWNWARZLMPQ-UHFFFAOYSA-N

SMILES: CC1=C2C(=CC=C1)NCC2.Cl

Synonyms:

• 1H-Indole, 2,3-dihydro-4-methyl-, hydrochloride (1:1)
• 4-Methylindoline hydrochloride

4-Methylindoline hydrochloride

CAS: 1187928-38-6

Formula: C₉H₁₂ClN

Molecular weight: 169.6513

Ref: IN-DA007PQF

4-Methylindoline hydrochloride

CAS: 1187928-38-6

Versatile small molecule scaffold

Formula: C₉H₁₂ClN

Purity: Min. 95%

Molecular weight: 169.65 g/mol

Ref: 3D-MXB92838