CAS 1187928-54-6

7-Bromo-2-benzothiazolecarboxylic acid

Description:

7-Bromo-2-benzothiazolecarboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiazole ring and a carboxylic acid functional group. The presence of the bromine atom at the 7-position of the benzothiazole enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. It is often used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The benzothiazole moiety is known for its applications in dye manufacturing, rubber processing, and as a building block in medicinal chemistry. Additionally, the compound may exhibit antimicrobial or antifungal properties, making it of interest in biological research. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₄BrNO₂S

InChI: InChI=1S/C8H4BrNO2S/c9-4-2-1-3-5-6(4)13-7(10-5)8(11)12/h1-3H,(H,11,12)

InChI key: InChIKey=UUHPYSFOZUWXIC-UHFFFAOYSA-N

SMILES: BrC1=C2C(N=C(C(O)=O)S2)=CC=C1

Synonyms:

• 7-Bromo-2-benzothiazolecarboxylic acid
• 2-Benzothiazolecarboxylic acid, 7-bromo-

7-Bromobenzo[d]thiazole-2-carboxylic acid

CAS: 1187928-54-6

Formula: C₈H₄BrNO₂S

Purity: 95.0%

Molecular weight: 258.09

Ref: 10-F431672