CAS 1187928-56-8: Isoquinoline, 3-(3-piperidinylmethyl)-, hydrochloride (1:2)

Description:Isoquinoline, 3-(3-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its isoquinoline core structure, which is a bicyclic aromatic compound. The presence of a piperidinylmethyl group at the 3-position of the isoquinoline ring enhances its pharmacological properties, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including drug formulation. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems, and could be investigated for therapeutic effects. Its molecular structure suggests it may have applications in the development of central nervous system agents or other therapeutic areas. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further research and characterization are essential to fully understand its properties and potential uses in pharmaceuticals or other fields.

Formula:C₁₅H₁₈N₂·2ClH

InChI:InChI=1S/C15H18N2.2ClH/c1-2-6-14-11-17-15(9-13(14)5-1)8-12-4-3-7-16-10-12;;/h1-2,5-6,9,11-12,16H,3-4,7-8,10H2;2*1H

InChI key:InChIKey=SUSMVTGZFPUOOS-UHFFFAOYSA-N

SMILES:Cl.N1=CC2=CC=CC=C2C=C1CC3CNCCC3