CymitQuimica logo

CAS 1187928-62-6

:

Methyl 4-bromo-2-benzothiazolecarboxylate

Description:
Methyl 4-bromo-2-benzothiazolecarboxylate is an organic compound characterized by its benzothiazole structure, which consists of a fused benzene and thiazole ring. The presence of a bromine atom at the 4-position and a carboxylate group at the 2-position contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the presence of functional groups that can participate in further chemical transformations. Additionally, the bromine substituent may enhance its biological activity or facilitate halogenation reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 4-bromo-2-benzothiazolecarboxylate is a compound of interest in synthetic organic chemistry and materials science.
Formula:C9H6BrNO2S
InChI:InChI=1S/C9H6BrNO2S/c1-13-9(12)8-11-7-5(10)3-2-4-6(7)14-8/h2-4H,1H3
InChI key:InChIKey=KTODNTHYJLARCN-UHFFFAOYSA-N
SMILES:BrC1=C2C(SC(C(OC)=O)=N2)=CC=C1
Synonyms:
  • 2-Benzothiazolecarboxylic acid, 4-bromo-, methyl ester
  • Methyl 4-bromo-2-benzothiazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.