CAS 1187928-66-0

1H-1,2,3-Triazole-1-ethanamine, 5-phenyl-, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-1-ethanamine, 5-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an ethylamine side chain and a phenyl group, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the triazole moiety is significant, as triazoles are known for their antifungal and antimicrobial properties. Additionally, the compound may exhibit unique reactivity due to the functional groups present, making it of interest in medicinal chemistry and drug development. Its CAS number, 1187928-66-0, allows for precise identification in chemical databases. Overall, this compound's structural features suggest potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.

Formula: C₁₀H₁₂N₄·ClH

InChI: InChI=1S/C10H12N4.ClH/c11-6-7-14-10(8-12-13-14)9-4-2-1-3-5-9;/h1-5,8H,6-7,11H2;1H

InChI key: InChIKey=ABHIGHCYPAFPPN-UHFFFAOYSA-N

SMILES: C(CN)N1C(=CN=N1)C2=CC=CC=C2.Cl

Synonyms:

• 1H-1,2,3-Triazole-1-ethanamine, 5-phenyl-, hydrochloride (1:1)