
CAS 1187928-73-9
:1H-Indole-6-carbonitrile, 1-ethyl-2,3-dihydro-, hydrochloride (1:1)
Description:
1H-Indole-6-carbonitrile, 1-ethyl-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carbonitrile group at the 6-position of the indole contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The ethyl substitution at the 1-position enhances its lipophilicity, which may influence its biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it easier to handle in laboratory settings. This compound may exhibit various pharmacological activities, and its derivatives are often explored for their potential therapeutic effects. The CAS number 1187928-73-9 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, the combination of its structural features suggests potential utility in drug development and research applications.
Formula:C11H12N2·ClH
InChI:InChI=1S/C11H12N2.ClH/c1-2-13-6-5-10-4-3-9(8-12)7-11(10)13;/h3-4,7H,2,5-6H2,1H3;1H
InChI key:InChIKey=IBCYMQWNVAVJPB-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(CC1)=CC=C(C#N)C2.Cl
Synonyms:- 1H-Indole-6-carbonitrile, 1-ethyl-2,3-dihydro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
