
CAS 1187928-79-5
:3-Bromo-5-chloro-N-methylbenzenamine
Description:
3-Bromo-5-chloro-N-methylbenzenamine is an organic compound characterized by the presence of both bromine and chlorine substituents on a benzene ring, along with a methylamino group. The compound features a bromine atom at the 3-position and a chlorine atom at the 5-position of the aromatic ring, which influences its reactivity and potential applications in various chemical reactions. The N-methyl group enhances the compound's solubility and can affect its biological activity. As a halogenated amine, it may exhibit properties such as increased lipophilicity and potential for nucleophilic substitution reactions. The presence of halogens can also impart unique characteristics, such as altered electronic properties and potential for use in pharmaceuticals or agrochemicals. Safety considerations are important, as halogenated compounds can sometimes be toxic or environmentally persistent. Overall, 3-Bromo-5-chloro-N-methylbenzenamine is a versatile compound with potential applications in synthetic chemistry and material science.
Formula:C7H7BrClN
InChI:InChI=1S/C7H7BrClN/c1-10-7-3-5(8)2-6(9)4-7/h2-4,10H,1H3
InChI key:InChIKey=UTCKDDDRCVDUCB-UHFFFAOYSA-N
SMILES:N(C)C1=CC(Br)=CC(Cl)=C1
Synonyms:- Benzenamine, 3-bromo-5-chloro-N-methyl-
- 3-Bromo-5-chloro-N-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.