CymitQuimica logo

CAS 1187928-85-3

:

4-(4-Bromophenyl)-1-methylpiperidine

Description:
4-(4-Bromophenyl)-1-methylpiperidine is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a bromophenyl group at the 4-position of the piperidine, contributing to its unique chemical properties. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methyl group at the 1-position of the piperidine ring adds to the steric and electronic characteristics of the molecule. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular structure allows for various interactions with biological targets, and its solubility and stability can vary based on the surrounding environment. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H16BrN
InChI:InChI=1S/C12H16BrN/c1-14-8-6-11(7-9-14)10-2-4-12(13)5-3-10/h2-5,11H,6-9H2,1H3
InChI key:InChIKey=XVFDTMOEUDZZFE-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C=C1)C2CCN(C)CC2
Synonyms:
  • Piperidine, 4-(4-bromophenyl)-1-methyl-
  • 4-(4-Bromophenyl)-1-methylpiperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.