CymitQuimica logo

CAS 1187928-86-4

:

3-Thiopheneethanamine, α-(trifluoromethyl)-, hydrochloride (1:1)

Description:
3-Thiopheneethanamine, α-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by the presence of a thiophene ring, an ethylamine side chain, and a trifluoromethyl group. The thiophene moiety contributes to its aromatic properties, while the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 1187928-86-4, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with many amines and halogenated compounds, due to potential toxicity and reactivity. Overall, this compound's unique structural characteristics suggest potential utility in research and development within the fields of organic chemistry and drug discovery.
Formula:C7H8F3NS·ClH
InChI:InChI=1S/C7H8F3NS.ClH/c8-7(9,10)6(11)3-5-1-2-12-4-5;/h1-2,4,6H,3,11H2;1H
InChI key:InChIKey=JHLAMNYMQIPBSI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(CC=1C=CSC1)N.Cl
Synonyms:
  • 3-Thiopheneethanamine, α-(trifluoromethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.