CAS 1187928-90-0: 2H-1-Benzopyran-4-amine, 6,8-difluoro-3,4-dihydro-, hydrochloride (1:1), (4S)-

Description: 2H-1-Benzopyran-4-amine, 6,8-difluoro-3,4-dihydro-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety and an amine functional group. The presence of difluoro substituents at the 6 and 8 positions enhances its chemical reactivity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The (4S)- designation indicates a specific stereochemistry, which can be crucial for the compound's interaction with biological targets. This compound may exhibit properties such as potential anti-inflammatory or anticancer activities, but specific biological effects would depend on further empirical studies. Its CAS number, 1187928-90-0, allows for precise identification in chemical databases, aiding in research and development efforts. Overall, this compound represents a class of organic molecules with potential therapeutic applications, warranting further investigation into its properties and effects.

Formula: C₉H₉F₂NO·ClH

InChI: InChI=1S/C9H9F2NO.ClH/c10-5-3-6-8(12)1-2-13-9(6)7(11)4-5;/h3-4,8H,1-2,12H2;1H/t8-;/m0./s1

InChI key: InChIKey=CRNZONGLYNSZNW-QRPNPIFTSA-N

SMILES: Cl.FC=1C=C(F)C=2OCCC(N)C2C1

Synonyms:

• 2H-1-Benzopyran-4-amine, 6,8-difluoro-3,4-dihydro-, hydrochloride (1:1), (4S)-

(4S)-6,8-Difluoro-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride

CAS: 1187928-90-0

Versatile small molecule scaffold

• Formula: C₉H₁₀ClF₂NO
• Purity: Min. 95%
• Molecular weight: 221.63 g/mol

(4s)-6,8-Difluoro-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride

CAS: 1187928-90-0

• Purity: 97%
• Molecular weight: 221.6300048828125