CymitQuimica logo

CAS 1187929-02-7

:

1-(4-Chloro-2-nitrophenyl)-3-azetidinecarboxylic acid

Description:
1-(4-Chloro-2-nitrophenyl)-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring—a four-membered cyclic amine—attached to a carboxylic acid group. The presence of a 4-chloro and a 2-nitro substituent on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties typical of both aromatic and aliphatic systems, influencing its solubility, stability, and interaction with biological targets. The carboxylic acid functional group can participate in hydrogen bonding and may affect the compound's acidity and reactivity in various chemical reactions. Additionally, the presence of halogen and nitro groups can enhance its electrophilic character, making it a candidate for further chemical modifications or applications in medicinal chemistry. Overall, this compound's structural features suggest potential utility in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C10H9ClN2O4
InChI:InChI=1S/C10H9ClN2O4/c11-7-1-2-8(9(3-7)13(16)17)12-4-6(5-12)10(14)15/h1-3,6H,4-5H2,(H,14,15)
InChI key:InChIKey=ODBMRECPBWEWDT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N2CC(C(O)=O)C2)C=CC(Cl)=C1
Synonyms:
  • 1-(4-Chloro-2-nitrophenyl)-3-azetidinecarboxylic acid
  • 3-Azetidinecarboxylic acid, 1-(4-chloro-2-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.