CymitQuimica logo

CAS 1187929-03-8

:

2H-1-Benzopyran-3-methanamine, 3,4-dihydro-6-methoxy-, hydrochloride (1:1)

Description:
2H-1-Benzopyran-3-methanamine, 3,4-dihydro-6-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzopyran core, an amine functional group, and a methoxy substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may influence its pharmacokinetic properties. The benzopyran moiety is known for its role in various natural products and pharmaceuticals, often exhibiting antioxidant and anti-inflammatory activities. The specific arrangement of substituents can affect the compound's reactivity, stability, and interaction with biological targets. As with many organic compounds, the characteristics such as melting point, boiling point, and solubility can vary based on the specific conditions and purity of the sample. Overall, this compound may hold significance in medicinal chemistry and pharmacology, warranting further investigation into its potential applications.
Formula:C11H15NO2·ClH
InChI:InChI=1S/C11H15NO2.ClH/c1-13-10-2-3-11-9(5-10)4-8(6-12)7-14-11;/h2-3,5,8H,4,6-7,12H2,1H3;1H
InChI key:InChIKey=YOKRSGWJLJQBPC-UHFFFAOYSA-N
SMILES:C(N)C1CC=2C(=CC=C(OC)C2)OC1.Cl
Synonyms:
  • 2H-1-Benzopyran-3-methanamine, 3,4-dihydro-6-methoxy-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.